C11H15ClN2OS — CID 65133698
1-(2-amino-5-chloro-3-pyridinyl)-2-tert-butylsulfanylethanone (PubChem CID 65133698) has the molecular formula C11H15ClN2OS and a molecular weight of 258.77 g/mol. Its IUPAC name is 1-(2-amino-5-chloro-3-pyridinyl)-2-tert-butylsulfanylethanone.
| Compound Name | 1-(2-amino-5-chloro-3-pyridinyl)-2-tert-butylsulfanylethanone |
|---|---|
| PubChem CID | 65133698 |
| Molecular Formula | C11H15ClN2OS |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 1-(2-amino-5-chloro-3-pyridinyl)-2-tert-butylsulfanylethanone |
| SMILES | CC(C)(C)SCC(=O)c1cc(Cl)cnc1N |
| InChI | InChI=1S/C11H15ClN2OS/c1-11(2,3)16-6-9(15)8-4-7(12)5-14-10(8)13/h4-5H,6H2,1-3H3,(H2,13,14) |
| InChIKey | MTIXTKZZWOMJGH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |