C14H13ClN2OS — CID 66139550
1-(2-amino-5-methyl-3-pyridinyl)-2-(2-chlorophenyl)sulfanylethanone (PubChem CID 66139550) has the molecular formula C14H13ClN2OS and a molecular weight of 292.79 g/mol. Its IUPAC name is 1-(2-amino-5-methyl-3-pyridinyl)-2-(2-chlorophenyl)sulfanylethanone.
| Compound Name | 1-(2-amino-5-methyl-3-pyridinyl)-2-(2-chlorophenyl)sulfanylethanone |
|---|---|
| PubChem CID | 66139550 |
| Molecular Formula | C14H13ClN2OS |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 1-(2-amino-5-methyl-3-pyridinyl)-2-(2-chlorophenyl)sulfanylethanone |
| SMILES | Cc1cnc(N)c(C(=O)CSc2ccccc2Cl)c1 |
| InChI | InChI=1S/C14H13ClN2OS/c1-9-6-10(14(16)17-7-9)12(18)8-19-13-5-3-2-4-11(13)15/h2-7H,8H2,1H3,(H2,16,17) |
| InChIKey | AYIXHAMXNYANBS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |