C10H14N2OS — CID 65130731
1-(2-amino-5-methyl-3-pyridinyl)-2-ethylsulfanylethanone (PubChem CID 65130731) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-(2-amino-5-methyl-3-pyridinyl)-2-ethylsulfanylethanone.
| Compound Name | 1-(2-amino-5-methyl-3-pyridinyl)-2-ethylsulfanylethanone |
|---|---|
| PubChem CID | 65130731 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-(2-amino-5-methyl-3-pyridinyl)-2-ethylsulfanylethanone |
| SMILES | CCSCC(=O)c1cc(C)cnc1N |
| InChI | InChI=1S/C10H14N2OS/c1-3-14-6-9(13)8-4-7(2)5-12-10(8)11/h4-5H,3,6H2,1-2H3,(H2,11,12) |
| InChIKey | RLTHOTLEMPPZNP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |