C17H8ClF4N — CID 133087890
5-chloro-2,3-bis(2,3-difluorophenyl)pyridine (PubChem CID 133087890) has the molecular formula C17H8ClF4N and a molecular weight of 337.70 g/mol. Its IUPAC name is 5-chloro-2,3-bis(2,3-difluorophenyl)pyridine.
| Compound Name | 5-chloro-2,3-bis(2,3-difluorophenyl)pyridine |
|---|---|
| PubChem CID | 133087890 |
| Molecular Formula | C17H8ClF4N |
| Molecular Weight | 337.70 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 5-chloro-2,3-bis(2,3-difluorophenyl)pyridine |
| SMILES | Fc1cccc(-c2cc(Cl)cnc2-c2cccc(F)c2F)c1F |
| InChI | InChI=1S/C17H8ClF4N/c18-9-7-12(10-3-1-5-13(19)15(10)21)17(23-8-9)11-4-2-6-14(20)16(11)22/h1-8H |
| InChIKey | IIAQQTZISRMVII-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.70 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |