C12H8ClF2NO — CID 133088408
3-chloro-2-(2,3-difluorophenyl)-5-methoxypyridine (PubChem CID 133088408) has the molecular formula C12H8ClF2NO and a molecular weight of 255.65 g/mol. Its IUPAC name is 3-chloro-2-(2,3-difluorophenyl)-5-methoxypyridine.
| Compound Name | 3-chloro-2-(2,3-difluorophenyl)-5-methoxypyridine |
|---|---|
| PubChem CID | 133088408 |
| Molecular Formula | C12H8ClF2NO |
| Molecular Weight | 255.65 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 3-chloro-2-(2,3-difluorophenyl)-5-methoxypyridine |
| SMILES | COc1cnc(-c2cccc(F)c2F)c(Cl)c1 |
| InChI | InChI=1S/C12H8ClF2NO/c1-17-7-5-9(13)12(16-6-7)8-3-2-4-10(14)11(8)15/h2-6H,1H3 |
| InChIKey | OVYTZWICYJXNSZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.65 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |