C23H9F8N — CID 133089036
2,4,6-tris(2,3-difluorophenyl)-3,5-difluoropyridine (PubChem CID 133089036) has the molecular formula C23H9F8N and a molecular weight of 451.32 g/mol. Its IUPAC name is 2,4,6-tris(2,3-difluorophenyl)-3,5-difluoropyridine.
| Compound Name | 2,4,6-tris(2,3-difluorophenyl)-3,5-difluoropyridine |
|---|---|
| PubChem CID | 133089036 |
| Molecular Formula | C23H9F8N |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 2,4,6-tris(2,3-difluorophenyl)-3,5-difluoropyridine |
| SMILES | Fc1cccc(-c2nc(-c3cccc(F)c3F)c(F)c(-c3cccc(F)c3F)c2F)c1F |
| InChI | InChI=1S/C23H9F8N/c24-13-7-1-4-10(17(13)27)16-20(30)22(11-5-2-8-14(25)18(11)28)32-23(21(16)31)12-6-3-9-15(26)19(12)29/h1-9H |
| InChIKey | LRCGWCZLAYBPLV-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |