C11H7Cl2FN2 — CID 130088674
2-(2,3-dichlorophenyl)-5-fluoropyridin-3-amine (PubChem CID 130088674) has the molecular formula C11H7Cl2FN2 and a molecular weight of 257.10 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-5-fluoropyridin-3-amine.
| Compound Name | 2-(2,3-dichlorophenyl)-5-fluoropyridin-3-amine |
|---|---|
| PubChem CID | 130088674 |
| Molecular Formula | C11H7Cl2FN2 |
| Molecular Weight | 257.10 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-5-fluoropyridin-3-amine |
| SMILES | Nc1cc(F)cnc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H7Cl2FN2/c12-8-3-1-2-7(10(8)13)11-9(15)4-6(14)5-16-11/h1-5H,15H2 |
| InChIKey | XXAGKUQCFCSCHU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.10 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |