C11H9Cl2N3 — CID 142143814
5-(2,3-dichlorophenyl)-6-methylpyrazin-2-amine (PubChem CID 142143814) has the molecular formula C11H9Cl2N3 and a molecular weight of 254.12 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-6-methylpyrazin-2-amine.
| Compound Name | 5-(2,3-dichlorophenyl)-6-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 142143814 |
| Molecular Formula | C11H9Cl2N3 |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-6-methylpyrazin-2-amine |
| SMILES | Cc1nc(N)cnc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H9Cl2N3/c1-6-11(15-5-9(14)16-6)7-3-2-4-8(12)10(7)13/h2-5H,1H3,(H2,14,16) |
| InChIKey | OKFGJBTYMLDIEY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |