C13H5Cl6F — CID 134622331
1,2,3,4,5-pentachloro-6-[3-(chloromethyl)-2-fluorophenyl]benzene (PubChem CID 134622331) has the molecular formula C13H5Cl6F and a molecular weight of 392.90 g/mol. Its IUPAC name is 1,2,3,4,5-pentachloro-6-[3-(chloromethyl)-2-fluorophenyl]benzene.
| Compound Name | 1,2,3,4,5-pentachloro-6-[3-(chloromethyl)-2-fluorophenyl]benzene |
|---|---|
| PubChem CID | 134622331 |
| Molecular Formula | C13H5Cl6F |
| Molecular Weight | 392.90 g/mol |
| Exact Mass | 389.85 |
| IUPAC Name | 1,2,3,4,5-pentachloro-6-[3-(chloromethyl)-2-fluorophenyl]benzene |
| SMILES | Fc1c(CCl)cccc1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H5Cl6F/c14-4-5-2-1-3-6(13(5)20)7-8(15)10(17)12(19)11(18)9(7)16/h1-3H,4H2 |
| InChIKey | BRQYKWOTFALXAG-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.90 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|