C13H4Cl5FO — CID 134620169
2-fluoro-3-(2,3,4,5,6-pentachlorophenyl)benzaldehyde (PubChem CID 134620169) has the molecular formula C13H4Cl5FO and a molecular weight of 372.44 g/mol. Its IUPAC name is 2-fluoro-3-(2,3,4,5,6-pentachlorophenyl)benzaldehyde.
| Compound Name | 2-fluoro-3-(2,3,4,5,6-pentachlorophenyl)benzaldehyde |
|---|---|
| PubChem CID | 134620169 |
| Molecular Formula | C13H4Cl5FO |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 369.87 |
| IUPAC Name | 2-fluoro-3-(2,3,4,5,6-pentachlorophenyl)benzaldehyde |
| SMILES | O=Cc1cccc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c1F |
| InChI | InChI=1S/C13H4Cl5FO/c14-8-7(9(15)11(17)12(18)10(8)16)6-3-1-2-5(4-20)13(6)19/h1-4H |
| InChIKey | OYRBMVLXQJHVSI-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|