C12H6Cl2FNO — CID 133090737
6-(2,3-dichlorophenyl)-2-fluoropyridine-3-carbaldehyde (PubChem CID 133090737) has the molecular formula C12H6Cl2FNO and a molecular weight of 270.09 g/mol. Its IUPAC name is 6-(2,3-dichlorophenyl)-2-fluoropyridine-3-carbaldehyde.
| Compound Name | 6-(2,3-dichlorophenyl)-2-fluoropyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 133090737 |
| Molecular Formula | C12H6Cl2FNO |
| Molecular Weight | 270.09 g/mol |
| Exact Mass | 268.98 |
| IUPAC Name | 6-(2,3-dichlorophenyl)-2-fluoropyridine-3-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cccc(Cl)c2Cl)nc1F |
| InChI | InChI=1S/C12H6Cl2FNO/c13-9-3-1-2-8(11(9)14)10-5-4-7(6-17)12(15)16-10/h1-6H |
| InChIKey | XQOXGKIRHJNNCP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.09 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|