C12H13BrF2 — CID 102642184
2-[2-(bromomethyl)-2-methylbut-3-enyl]-1,3-difluorobenzene (PubChem CID 102642184) has the molecular formula C12H13BrF2 and a molecular weight of 275.14 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-2-methylbut-3-enyl]-1,3-difluorobenzene.
| Compound Name | 2-[2-(bromomethyl)-2-methylbut-3-enyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 102642184 |
| Molecular Formula | C12H13BrF2 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-[2-(bromomethyl)-2-methylbut-3-enyl]-1,3-difluorobenzene |
| SMILES | C=CC(C)(CBr)Cc1c(F)cccc1F |
| InChI | InChI=1S/C12H13BrF2/c1-3-12(2,8-13)7-9-10(14)5-4-6-11(9)15/h3-6H,1,7-8H2,2H3 |
| InChIKey | UGVWHBNOFFUUON-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|