C15H19ClFN — CID 102641163
N-[2-[(2-chloro-6-fluorophenyl)methyl]-2-methylbut-3-enyl]cyclopropanamine (PubChem CID 102641163) has the molecular formula C15H19ClFN and a molecular weight of 267.77 g/mol. Its IUPAC name is N-[2-[(2-chloro-6-fluorophenyl)methyl]-2-methylbut-3-enyl]cyclopropanamine.
| Compound Name | N-[2-[(2-chloro-6-fluorophenyl)methyl]-2-methylbut-3-enyl]cyclopropanamine |
|---|---|
| PubChem CID | 102641163 |
| Molecular Formula | C15H19ClFN |
| Molecular Weight | 267.77 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-[2-[(2-chloro-6-fluorophenyl)methyl]-2-methylbut-3-enyl]cyclopropanamine |
| SMILES | C=CC(C)(CNC1CC1)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C15H19ClFN/c1-3-15(2,10-18-11-7-8-11)9-12-13(16)5-4-6-14(12)17/h3-6,11,18H,1,7-10H2,2H3 |
| InChIKey | ODTJRQDAAQRTRZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.77 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|