C15H18BrF2N — CID 106271907
N-[2-[(3-bromo-2,6-difluorophenyl)methyl]-2-methylbut-3-enyl]cyclopropanamine (PubChem CID 106271907) has the molecular formula C15H18BrF2N and a molecular weight of 330.22 g/mol. Its IUPAC name is N-[2-[(3-bromo-2,6-difluorophenyl)methyl]-2-methylbut-3-enyl]cyclopropanamine.
| Compound Name | N-[2-[(3-bromo-2,6-difluorophenyl)methyl]-2-methylbut-3-enyl]cyclopropanamine |
|---|---|
| PubChem CID | 106271907 |
| Molecular Formula | C15H18BrF2N |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | N-[2-[(3-bromo-2,6-difluorophenyl)methyl]-2-methylbut-3-enyl]cyclopropanamine |
| SMILES | C=CC(C)(CNC1CC1)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H18BrF2N/c1-3-15(2,9-19-10-4-5-10)8-11-13(17)7-6-12(16)14(11)18/h3,6-7,10,19H,1,4-5,8-9H2,2H3 |
| InChIKey | UHMYBQPXFNWGDO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|