C14H11ClF2O3S — CID 114930150
4-[(2,6-difluorophenyl)methoxy]-3-methylbenzenesulfonyl chloride (PubChem CID 114930150) has the molecular formula C14H11ClF2O3S and a molecular weight of 332.76 g/mol. Its IUPAC name is 4-[(2,6-difluorophenyl)methoxy]-3-methylbenzenesulfonyl chloride.
| Compound Name | 4-[(2,6-difluorophenyl)methoxy]-3-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 114930150 |
| Molecular Formula | C14H11ClF2O3S |
| Molecular Weight | 332.76 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 4-[(2,6-difluorophenyl)methoxy]-3-methylbenzenesulfonyl chloride |
| SMILES | Cc1cc(S(=O)(=O)Cl)ccc1OCc1c(F)cccc1F |
| InChI | InChI=1S/C14H11ClF2O3S/c1-9-7-10(21(15,18)19)5-6-14(9)20-8-11-12(16)3-2-4-13(11)17/h2-7H,8H2,1H3 |
| InChIKey | CJJHJWNYLYKTNB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.76 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |