C21H28IN3O3 — CID 111841345
methyl 4-[[[(cyclopentylamino)-[2-(furan-2-yl)ethylamino]methylidene]amino]methyl]benzoate;hydroiodide (PubChem CID 111841345) has the molecular formula C21H28IN3O3 and a molecular weight of 497.38 g/mol. Its IUPAC name is methyl 4-[[[(cyclopentylamino)-[2-(furan-2-yl)ethylamino]methylidene]amino]methyl]benzoate;hydroiodide.
| Compound Name | methyl 4-[[[(cyclopentylamino)-[2-(furan-2-yl)ethylamino]methylidene]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111841345 |
| Molecular Formula | C21H28IN3O3 |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | methyl 4-[[[(cyclopentylamino)-[2-(furan-2-yl)ethylamino]methylidene]amino]methyl]benzoate;hydroiodide |
| SMILES | COC(=O)c1ccc(C/N=C(\NCCc2ccco2)NC2CCCC2)cc1.I |
| InChI | InChI=1S/C21H27N3O3.HI/c1-26-20(25)17-10-8-16(9-11-17)15-23-21(24-18-5-2-3-6-18)22-13-12-19-7-4-14-27-19;/h4,7-11,14,18H,2-3,5-6,12-13,15H2,1H3,(H2,22,23,24);1H |
| InChIKey | YANQFNGMOGXZKZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|