C16H25NO2 — CID 107710365
2-[1-(cyclooctylamino)ethyl]benzene-1,3-diol (PubChem CID 107710365) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-[1-(cyclooctylamino)ethyl]benzene-1,3-diol.
| Compound Name | 2-[1-(cyclooctylamino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107710365 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2-[1-(cyclooctylamino)ethyl]benzene-1,3-diol |
| SMILES | CC(NC1CCCCCCC1)c1c(O)cccc1O |
| InChI | InChI=1S/C16H25NO2/c1-12(16-14(18)10-7-11-15(16)19)17-13-8-5-3-2-4-6-9-13/h7,10-13,17-19H,2-6,8-9H2,1H3 |
| InChIKey | WZXGXGXCDUJLOY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|