C13H19N — CID 130674214
N-[1-(2,6-dimethylphenyl)ethyl]cyclopropanamine (PubChem CID 130674214) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is N-[1-(2,6-dimethylphenyl)ethyl]cyclopropanamine.
| Compound Name | N-[1-(2,6-dimethylphenyl)ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 130674214 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | N-[1-(2,6-dimethylphenyl)ethyl]cyclopropanamine |
| SMILES | Cc1cccc(C)c1C(C)NC1CC1 |
| InChI | InChI=1S/C13H19N/c1-9-5-4-6-10(2)13(9)11(3)14-12-7-8-12/h4-6,11-12,14H,7-8H2,1-3H3 |
| InChIKey | QISFVNGBMYSADL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |