C17H27NO2 — CID 107710869
2-[1-[(4-propylcyclohexyl)amino]ethyl]benzene-1,3-diol (PubChem CID 107710869) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-[1-[(4-propylcyclohexyl)amino]ethyl]benzene-1,3-diol.
| Compound Name | 2-[1-[(4-propylcyclohexyl)amino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107710869 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-[1-[(4-propylcyclohexyl)amino]ethyl]benzene-1,3-diol |
| SMILES | CCCC1CCC(NC(C)c2c(O)cccc2O)CC1 |
| InChI | InChI=1S/C17H27NO2/c1-3-5-13-8-10-14(11-9-13)18-12(2)17-15(19)6-4-7-16(17)20/h4,6-7,12-14,18-20H,3,5,8-11H2,1-2H3 |
| InChIKey | XVUVMHQYMCVBNX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|