C17H26ClN — CID 29040454
N-[(1R)-1-(2-chlorophenyl)ethyl]-4-propylcyclohexan-1-amine (PubChem CID 29040454) has the molecular formula C17H26ClN and a molecular weight of 279.85 g/mol. Its IUPAC name is N-[(1R)-1-(2-chlorophenyl)ethyl]-4-propylcyclohexan-1-amine.
| Compound Name | N-[(1R)-1-(2-chlorophenyl)ethyl]-4-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 29040454 |
| Molecular Formula | C17H26ClN |
| Molecular Weight | 279.85 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | N-[(1R)-1-(2-chlorophenyl)ethyl]-4-propylcyclohexan-1-amine |
| SMILES | CCCC1CCC(N[C@H](C)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H26ClN/c1-3-6-14-9-11-15(12-10-14)19-13(2)16-7-4-5-8-17(16)18/h4-5,7-8,13-15,19H,3,6,9-12H2,1-2H3/t13-,14?,15?/m1/s1 |
| InChIKey | LUOGAEZTZNDSJH-WLYUNCDWSA-N |
| XLogP | 5.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.85 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |