C17H16N2O6S2 — CID 137355462
3-amino-5-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylsulfonylethyl]thieno[3,4-c]pyrrole-4,6-dione (PubChem CID 137355462) has the molecular formula C17H16N2O6S2 and a molecular weight of 408.46 g/mol. Its IUPAC name is 3-amino-5-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylsulfonylethyl]thieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 3-amino-5-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylsulfonylethyl]thieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 137355462 |
| Molecular Formula | C17H16N2O6S2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 3-amino-5-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylsulfonylethyl]thieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CS(=O)(=O)C[C@H](c1ccc2c(c1)OCCO2)N1C(=O)c2csc(N)c2C1=O |
| InChI | InChI=1S/C17H16N2O6S2/c1-27(22,23)8-11(9-2-3-12-13(6-9)25-5-4-24-12)19-16(20)10-7-26-15(18)14(10)17(19)21/h2-3,6-7,11H,4-5,8,18H2,1H3/t11-/m1/s1 |
| InChIKey | BQYBEFJETWLHBZ-LLVKDONJSA-N |
| XLogP | 1.48 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|