C19H18N2O8S2 — CID 137355426
N-[5-[1-(1,3-benzodioxol-5-yl)-2-methylsulfonylethyl]-4,6-dioxothieno[2,3-c]pyrrol-3-yl]-2-methoxyacetamide (PubChem CID 137355426) has the molecular formula C19H18N2O8S2 and a molecular weight of 466.49 g/mol. Its IUPAC name is N-[5-[1-(1,3-benzodioxol-5-yl)-2-methylsulfonylethyl]-4,6-dioxothieno[2,3-c]pyrrol-3-yl]-2-methoxyacetamide.
| Compound Name | N-[5-[1-(1,3-benzodioxol-5-yl)-2-methylsulfonylethyl]-4,6-dioxothieno[2,3-c]pyrrol-3-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 137355426 |
| Molecular Formula | C19H18N2O8S2 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | N-[5-[1-(1,3-benzodioxol-5-yl)-2-methylsulfonylethyl]-4,6-dioxothieno[2,3-c]pyrrol-3-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1csc2c1C(=O)N(C(CS(C)(=O)=O)c1ccc3c(c1)OCO3)C2=O |
| InChI | InChI=1S/C19H18N2O8S2/c1-27-6-15(22)20-11-7-30-17-16(11)18(23)21(19(17)24)12(8-31(2,25)26)10-3-4-13-14(5-10)29-9-28-13/h3-5,7,12H,6,8-9H2,1-2H3,(H,20,22) |
| InChIKey | VOTXSXHEECEZMH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|