methyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate

C14H17NO4 — CID 116860526

IUPACmethyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate
SMILESCOC(=O)C(c1ccc2c(c1)OCO2)N1CCCC1
InChIInChI=1S/C14H17NO4/c1-17-14(16)13(15-6-2-3-7-15)10-4-5-11-12(8-10)19-9-18-11/h4-5,8,13H,2-3,6-7,9H2,1H3
InChIKeyYCEXUMXMKFOOSP-UHFFFAOYSA-N
MW263.29 g/mol
LogP1.73
Rot. Bonds3

About methyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate

methyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate (PubChem CID 116860526) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate.

Molecular Properties

Compound Namemethyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate
PubChem CID116860526
Molecular FormulaC14H17NO4
Molecular Weight263.29 g/mol
Exact Mass263.12
IUPAC Namemethyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate
SMILESCOC(=O)C(c1ccc2c(c1)OCO2)N1CCCC1
InChIInChI=1S/C14H17NO4/c1-17-14(16)13(15-6-2-3-7-15)10-4-5-11-12(8-10)19-9-18-11/h4-5,8,13H,2-3,6-7,9H2,1H3
InChIKeyYCEXUMXMKFOOSP-UHFFFAOYSA-N
XLogP1.73
TPSA48.00 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.29
LogP ≤ 51.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate?
The IUPAC name of methyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate (CID 116860526) is methyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate.
What is the SMILES notation for methyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate?
The canonical SMILES for methyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate is COC(=O)C(c1ccc2c(c1)OCO2)N1CCCC1.
What is the InChIKey of methyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate?
The InChIKey is YCEXUMXMKFOOSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c1-17-14(16)13(15-6-2-3-7-15)10-4-5-11-12(8-10)19-9-18-11/h4-5,8,13H,2-3,6-7,9H2,1H3.
What are the key properties of methyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate?
methyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate has a molecular weight of 263.29 g/mol, XLogP of 1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylacetate is sourced from PubChem (CID 116860526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).