C14H16N2O3 — CID 116860541
methyl 2-(1,3-benzoxazol-6-yl)-2-pyrrolidin-1-ylacetate (PubChem CID 116860541) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is methyl 2-(1,3-benzoxazol-6-yl)-2-pyrrolidin-1-ylacetate.
| Compound Name | methyl 2-(1,3-benzoxazol-6-yl)-2-pyrrolidin-1-ylacetate |
|---|---|
| PubChem CID | 116860541 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | methyl 2-(1,3-benzoxazol-6-yl)-2-pyrrolidin-1-ylacetate |
| SMILES | COC(=O)C(c1ccc2ncoc2c1)N1CCCC1 |
| InChI | InChI=1S/C14H16N2O3/c1-18-14(17)13(16-6-2-3-7-16)10-4-5-11-12(8-10)19-9-15-11/h4-5,8-9,13H,2-3,6-7H2,1H3 |
| InChIKey | IUCRLQIYICFHMH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |