C10H11NO — CID 21354846
6-propan-2-yl-1,3-benzoxazole (PubChem CID 21354846) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 6-propan-2-yl-1,3-benzoxazole.
| Compound Name | 6-propan-2-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 21354846 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 6-propan-2-yl-1,3-benzoxazole |
| SMILES | CC(C)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C10H11NO/c1-7(2)8-3-4-9-10(5-8)12-6-11-9/h3-7H,1-2H3 |
| InChIKey | UZNGQOLSLIKEDO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |