C10H11ClN2O — CID 116915255
1-(1,3-benzoxazol-6-yl)-1-chloro-N,N-dimethylmethanamine (PubChem CID 116915255) has the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-6-yl)-1-chloro-N,N-dimethylmethanamine.
| Compound Name | 1-(1,3-benzoxazol-6-yl)-1-chloro-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 116915255 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1-(1,3-benzoxazol-6-yl)-1-chloro-N,N-dimethylmethanamine |
| SMILES | CN(C)C(Cl)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C10H11ClN2O/c1-13(2)10(11)7-3-4-8-9(5-7)14-6-12-8/h3-6,10H,1-2H3 |
| InChIKey | CNYMZQIJWHCGRX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|