C9H9NO2S — CID 116830039
1-(1,3-benzoxazol-6-yl)-2-sulfanylethanol (PubChem CID 116830039) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-6-yl)-2-sulfanylethanol.
| Compound Name | 1-(1,3-benzoxazol-6-yl)-2-sulfanylethanol |
|---|---|
| PubChem CID | 116830039 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 1-(1,3-benzoxazol-6-yl)-2-sulfanylethanol |
| SMILES | OC(CS)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C9H9NO2S/c11-8(4-13)6-1-2-7-9(3-6)12-5-10-7/h1-3,5,8,11,13H,4H2 |
| InChIKey | PJJWYPIQIQBDOE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|