C11H13NO2S — CID 116831147
1-(1,3-benzoxazol-6-yl)-3-methylsulfanylpropan-1-ol (PubChem CID 116831147) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-6-yl)-3-methylsulfanylpropan-1-ol.
| Compound Name | 1-(1,3-benzoxazol-6-yl)-3-methylsulfanylpropan-1-ol |
|---|---|
| PubChem CID | 116831147 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 1-(1,3-benzoxazol-6-yl)-3-methylsulfanylpropan-1-ol |
| SMILES | CSCCC(O)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C11H13NO2S/c1-15-5-4-10(13)8-2-3-9-11(6-8)14-7-12-9/h2-3,6-7,10,13H,4-5H2,1H3 |
| InChIKey | QNGFKRAKRRCHNV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |