C12H15N3O — CID 116937387
3-[amino(1,3-benzoxazol-6-yl)methyl]cyclobutan-1-amine (PubChem CID 116937387) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-[amino(1,3-benzoxazol-6-yl)methyl]cyclobutan-1-amine.
| Compound Name | 3-[amino(1,3-benzoxazol-6-yl)methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 116937387 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 3-[amino(1,3-benzoxazol-6-yl)methyl]cyclobutan-1-amine |
| SMILES | NC1CC(C(N)c2ccc3ncoc3c2)C1 |
| InChI | InChI=1S/C12H15N3O/c13-9-3-8(4-9)12(14)7-1-2-10-11(5-7)16-6-15-10/h1-2,5-6,8-9,12H,3-4,13-14H2 |
| InChIKey | FJBMTSDVWPOIRH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |