C13H17N3O2 — CID 116941514
1-(1,3-benzoxazol-6-yl)-2-morpholin-3-ylethanamine (PubChem CID 116941514) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-6-yl)-2-morpholin-3-ylethanamine.
| Compound Name | 1-(1,3-benzoxazol-6-yl)-2-morpholin-3-ylethanamine |
|---|---|
| PubChem CID | 116941514 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 1-(1,3-benzoxazol-6-yl)-2-morpholin-3-ylethanamine |
| SMILES | NC(CC1COCCN1)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C13H17N3O2/c14-11(6-10-7-17-4-3-15-10)9-1-2-12-13(5-9)18-8-16-12/h1-2,5,8,10-11,15H,3-4,6-7,14H2 |
| InChIKey | NPNUBRGCVJPREX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |