C12H15N3O — CID 116935433
1,3-benzoxazol-6-yl(pyrrolidin-2-yl)methanamine (PubChem CID 116935433) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 1,3-benzoxazol-6-yl(pyrrolidin-2-yl)methanamine.
| Compound Name | 1,3-benzoxazol-6-yl(pyrrolidin-2-yl)methanamine |
|---|---|
| PubChem CID | 116935433 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 1,3-benzoxazol-6-yl(pyrrolidin-2-yl)methanamine |
| SMILES | NC(c1ccc2ncoc2c1)C1CCCN1 |
| InChI | InChI=1S/C12H15N3O/c13-12(10-2-1-5-14-10)8-3-4-9-11(6-8)16-7-15-9/h3-4,6-7,10,12,14H,1-2,5,13H2 |
| InChIKey | YBUMANCVMXGDDP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |