C14H16N2O2 — CID 116941976
4-[amino(1,3-benzoxazol-6-yl)methyl]cyclohexan-1-one (PubChem CID 116941976) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-[amino(1,3-benzoxazol-6-yl)methyl]cyclohexan-1-one.
| Compound Name | 4-[amino(1,3-benzoxazol-6-yl)methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 116941976 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 4-[amino(1,3-benzoxazol-6-yl)methyl]cyclohexan-1-one |
| SMILES | NC(c1ccc2ncoc2c1)C1CCC(=O)CC1 |
| InChI | InChI=1S/C14H16N2O2/c15-14(9-1-4-11(17)5-2-9)10-3-6-12-13(7-10)18-8-16-12/h3,6-9,14H,1-2,4-5,15H2 |
| InChIKey | UODVFHWHHHNEOV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |