C14H16N2O2 — CID 116870823
6-(3-pyrrolidin-2-yloxetan-3-yl)-1,3-benzoxazole (PubChem CID 116870823) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 6-(3-pyrrolidin-2-yloxetan-3-yl)-1,3-benzoxazole.
| Compound Name | 6-(3-pyrrolidin-2-yloxetan-3-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 116870823 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 6-(3-pyrrolidin-2-yloxetan-3-yl)-1,3-benzoxazole |
| SMILES | c1nc2ccc(C3(C4CCCN4)COC3)cc2o1 |
| InChI | InChI=1S/C14H16N2O2/c1-2-13(15-5-1)14(7-17-8-14)10-3-4-11-12(6-10)18-9-16-11/h3-4,6,9,13,15H,1-2,5,7-8H2 |
| InChIKey | WFRFBCSOHMXYCI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |