C13H12N2O2 — CID 116873395
3-[3-(1,3-benzoxazol-6-yl)oxetan-3-yl]propanenitrile (PubChem CID 116873395) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 3-[3-(1,3-benzoxazol-6-yl)oxetan-3-yl]propanenitrile.
| Compound Name | 3-[3-(1,3-benzoxazol-6-yl)oxetan-3-yl]propanenitrile |
|---|---|
| PubChem CID | 116873395 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 3-[3-(1,3-benzoxazol-6-yl)oxetan-3-yl]propanenitrile |
| SMILES | N#CCCC1(c2ccc3ncoc3c2)COC1 |
| InChI | InChI=1S/C13H12N2O2/c14-5-1-4-13(7-16-8-13)10-2-3-11-12(6-10)17-9-15-11/h2-3,6,9H,1,4,7-8H2 |
| InChIKey | UUNNEUSHNGFPFF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |