C14H19N3O — CID 115214300
3-[[2-(1,3-benzoxazol-6-yl)ethylamino]methyl]cyclobutan-1-amine (PubChem CID 115214300) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 3-[[2-(1,3-benzoxazol-6-yl)ethylamino]methyl]cyclobutan-1-amine.
| Compound Name | 3-[[2-(1,3-benzoxazol-6-yl)ethylamino]methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 115214300 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 3-[[2-(1,3-benzoxazol-6-yl)ethylamino]methyl]cyclobutan-1-amine |
| SMILES | NC1CC(CNCCc2ccc3ncoc3c2)C1 |
| InChI | InChI=1S/C14H19N3O/c15-12-5-11(6-12)8-16-4-3-10-1-2-13-14(7-10)18-9-17-13/h1-2,7,9,11-12,16H,3-6,8,15H2 |
| InChIKey | AXTJWRZNDAVACP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|