C14H17BrN2O4 — CID 61002959
methyl 2-(7-bromo-1,3-benzodioxol-5-yl)-2-piperazin-1-ylacetate (PubChem CID 61002959) has the molecular formula C14H17BrN2O4 and a molecular weight of 357.20 g/mol. Its IUPAC name is methyl 2-(7-bromo-1,3-benzodioxol-5-yl)-2-piperazin-1-ylacetate.
| Compound Name | methyl 2-(7-bromo-1,3-benzodioxol-5-yl)-2-piperazin-1-ylacetate |
|---|---|
| PubChem CID | 61002959 |
| Molecular Formula | C14H17BrN2O4 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | methyl 2-(7-bromo-1,3-benzodioxol-5-yl)-2-piperazin-1-ylacetate |
| SMILES | COC(=O)C(c1cc(Br)c2c(c1)OCO2)N1CCNCC1 |
| InChI | InChI=1S/C14H17BrN2O4/c1-19-14(18)12(17-4-2-16-3-5-17)9-6-10(15)13-11(7-9)20-8-21-13/h6-7,12,16H,2-5,8H2,1H3 |
| InChIKey | OADFZEYZVBECQB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |