C13H14BrN3O2 — CID 43326692
2-(7-bromo-1,3-benzodioxol-5-yl)-2-piperazin-1-ylacetonitrile (PubChem CID 43326692) has the molecular formula C13H14BrN3O2 and a molecular weight of 324.18 g/mol. Its IUPAC name is 2-(7-bromo-1,3-benzodioxol-5-yl)-2-piperazin-1-ylacetonitrile.
| Compound Name | 2-(7-bromo-1,3-benzodioxol-5-yl)-2-piperazin-1-ylacetonitrile |
|---|---|
| PubChem CID | 43326692 |
| Molecular Formula | C13H14BrN3O2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-(7-bromo-1,3-benzodioxol-5-yl)-2-piperazin-1-ylacetonitrile |
| SMILES | N#CC(c1cc(Br)c2c(c1)OCO2)N1CCNCC1 |
| InChI | InChI=1S/C13H14BrN3O2/c14-10-5-9(6-12-13(10)19-8-18-12)11(7-15)17-3-1-16-2-4-17/h5-6,11,16H,1-4,8H2 |
| InChIKey | ROVUNEBMYSBRTF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |