C10H14N2O4S — CID 95135138
6-[(1R)-1-(sulfamoylamino)ethyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 95135138) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 6-[(1R)-1-(sulfamoylamino)ethyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-[(1R)-1-(sulfamoylamino)ethyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 95135138 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 6-[(1R)-1-(sulfamoylamino)ethyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | C[C@@H](NS(N)(=O)=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C10H14N2O4S/c1-7(12-17(11,13)14)8-2-3-9-10(6-8)16-5-4-15-9/h2-3,6-7,12H,4-5H2,1H3,(H2,11,13,14)/t7-/m1/s1 |
| InChIKey | YTXSATWPAOQFAJ-SSDOTTSWSA-N |
| XLogP | 0.31 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |