C11H15NO4S — CID 22773282
N-[1-(1,3-benzodioxol-5-yl)ethyl]ethanesulfonamide (PubChem CID 22773282) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]ethanesulfonamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 22773282 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC(C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H15NO4S/c1-3-17(13,14)12-8(2)9-4-5-10-11(6-9)16-7-15-10/h4-6,8,12H,3,7H2,1-2H3 |
| InChIKey | BJAYYYLPKKMYSW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |