C23H26N2O9S2 — CID 71172559
N-[2-[1-(3-ethoxy-4-methoxyphenyl)-3-oxobutyl]-1,3-dioxoisoindol-4-yl]-N-methylsulfonylmethanesulfonamide (PubChem CID 71172559) has the molecular formula C23H26N2O9S2 and a molecular weight of 538.60 g/mol. Its IUPAC name is N-[2-[1-(3-ethoxy-4-methoxyphenyl)-3-oxobutyl]-1,3-dioxoisoindol-4-yl]-N-methylsulfonylmethanesulfonamide.
| Compound Name | N-[2-[1-(3-ethoxy-4-methoxyphenyl)-3-oxobutyl]-1,3-dioxoisoindol-4-yl]-N-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 71172559 |
| Molecular Formula | C23H26N2O9S2 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | N-[2-[1-(3-ethoxy-4-methoxyphenyl)-3-oxobutyl]-1,3-dioxoisoindol-4-yl]-N-methylsulfonylmethanesulfonamide |
| SMILES | CCOc1cc(C(CC(C)=O)N2C(=O)c3cccc(N(S(C)(=O)=O)S(C)(=O)=O)c3C2=O)ccc1OC |
| InChI | InChI=1S/C23H26N2O9S2/c1-6-34-20-13-15(10-11-19(20)33-3)18(12-14(2)26)24-22(27)16-8-7-9-17(21(16)23(24)28)25(35(4,29)30)36(5,31)32/h7-11,13,18H,6,12H2,1-5H3 |
| InChIKey | HLKPGXFJTOQDDN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 144.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|