C22H19NO9 — CID 102330547
methyl (2S,3S)-3-(3,4-diacetyloxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxypropanoate (PubChem CID 102330547) has the molecular formula C22H19NO9 and a molecular weight of 441.39 g/mol. Its IUPAC name is methyl (2S,3S)-3-(3,4-diacetyloxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxypropanoate.
| Compound Name | methyl (2S,3S)-3-(3,4-diacetyloxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 102330547 |
| Molecular Formula | C22H19NO9 |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | methyl (2S,3S)-3-(3,4-diacetyloxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxypropanoate |
| SMILES | COC(=O)[C@H]([C@@H](O)c1ccc(OC(C)=O)c(OC(C)=O)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H19NO9/c1-11(24)31-16-9-8-13(10-17(16)32-12(2)25)19(26)18(22(29)30-3)23-20(27)14-6-4-5-7-15(14)21(23)28/h4-10,18-19,26H,1-3H3/t18-,19-/m0/s1 |
| InChIKey | MENLPYIFQVZSOS-OALUTQOASA-N |
| XLogP | 1.41 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|