C16H16F3NO5 — CID 175539525
methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3,4,7-trifluoro-6-hydroxyheptanoate (PubChem CID 175539525) has the molecular formula C16H16F3NO5 and a molecular weight of 359.30 g/mol. Its IUPAC name is methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3,4,7-trifluoro-6-hydroxyheptanoate.
| Compound Name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3,4,7-trifluoro-6-hydroxyheptanoate |
|---|---|
| PubChem CID | 175539525 |
| Molecular Formula | C16H16F3NO5 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3,4,7-trifluoro-6-hydroxyheptanoate |
| SMILES | COC(=O)[C@@H](C(F)C(F)CC(O)CF)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H16F3NO5/c1-25-16(24)13(12(19)11(18)6-8(21)7-17)20-14(22)9-4-2-3-5-10(9)15(20)23/h2-5,8,11-13,21H,6-7H2,1H3/t8?,11?,12?,13-/m1/s1 |
| InChIKey | NUVHJTLEAATEMO-DFXUYWBRSA-N |
| XLogP | 1.22 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|