C20H15BrINO6 — CID 102330538
methyl (2R,3S)-3-(4-acetyloxy-3-iodophenyl)-3-bromo-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 102330538) has the molecular formula C20H15BrINO6 and a molecular weight of 572.15 g/mol. Its IUPAC name is methyl (2R,3S)-3-(4-acetyloxy-3-iodophenyl)-3-bromo-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | methyl (2R,3S)-3-(4-acetyloxy-3-iodophenyl)-3-bromo-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 102330538 |
| Molecular Formula | C20H15BrINO6 |
| Molecular Weight | 572.15 g/mol |
| Exact Mass | 570.91 |
| IUPAC Name | methyl (2R,3S)-3-(4-acetyloxy-3-iodophenyl)-3-bromo-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | COC(=O)[C@H]([C@@H](Br)c1ccc(OC(C)=O)c(I)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H15BrINO6/c1-10(24)29-15-8-7-11(9-14(15)22)16(21)17(20(27)28-2)23-18(25)12-5-3-4-6-13(12)19(23)26/h3-9,16-17H,1-2H3/t16-,17-/m0/s1 |
| InChIKey | CAHXIQIMQNTILY-IRXDYDNUSA-N |
| XLogP | 3.49 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.15 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|