C13H10N2O5 — CID 175293844
2-[1-(5-oxo-1,4,2-dioxazol-3-yl)propan-2-yl]isoindole-1,3-dione (PubChem CID 175293844) has the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. Its IUPAC name is 2-[1-(5-oxo-1,4,2-dioxazol-3-yl)propan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-(5-oxo-1,4,2-dioxazol-3-yl)propan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175293844 |
| Molecular Formula | C13H10N2O5 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-[1-(5-oxo-1,4,2-dioxazol-3-yl)propan-2-yl]isoindole-1,3-dione |
| SMILES | CC(Cc1noc(=O)o1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H10N2O5/c1-7(6-10-14-20-13(18)19-10)15-11(16)8-4-2-3-5-9(8)12(15)17/h2-5,7H,6H2,1H3 |
| InChIKey | PEIBOEHGIZPHRJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 93.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|