C26H28N2O5 — CID 10388968
2-[(2S)-1-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutoxy]-3-methylbutan-2-yl]isoindole-1,3-dione (PubChem CID 10388968) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-[(2S)-1-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutoxy]-3-methylbutan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-1-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutoxy]-3-methylbutan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10388968 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2-[(2S)-1-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutoxy]-3-methylbutan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C)[C@@H](COC[C@H](C(C)C)N1C(=O)c2ccccc2C1=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H28N2O5/c1-15(2)21(27-23(29)17-9-5-6-10-18(17)24(27)30)13-33-14-22(16(3)4)28-25(31)19-11-7-8-12-20(19)26(28)32/h5-12,15-16,21-22H,13-14H2,1-4H3/t21-,22-/m1/s1 |
| InChIKey | RIVJCCKTGAQUEW-FGZHOGPDSA-N |
| XLogP | 3.64 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|