C19H17NO5 — CID 102589815
[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-phenoxypropan-2-yl] acetate (PubChem CID 102589815) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is [(2S)-1-(1,3-dioxoisoindol-2-yl)-3-phenoxypropan-2-yl] acetate.
| Compound Name | [(2S)-1-(1,3-dioxoisoindol-2-yl)-3-phenoxypropan-2-yl] acetate |
|---|---|
| PubChem CID | 102589815 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | [(2S)-1-(1,3-dioxoisoindol-2-yl)-3-phenoxypropan-2-yl] acetate |
| SMILES | CC(=O)O[C@H](COc1ccccc1)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H17NO5/c1-13(21)25-15(12-24-14-7-3-2-4-8-14)11-20-18(22)16-9-5-6-10-17(16)19(20)23/h2-10,15H,11-12H2,1H3/t15-/m0/s1 |
| InChIKey | HJWXQSRPYMPZKN-HNNXBMFYSA-N |
| XLogP | 2.29 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|