C20H22BrNO2 — CID 174593701
2-(4-bromo-2-ethylhexyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 174593701) has the molecular formula C20H22BrNO2 and a molecular weight of 388.31 g/mol. Its IUPAC name is 2-(4-bromo-2-ethylhexyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(4-bromo-2-ethylhexyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 174593701 |
| Molecular Formula | C20H22BrNO2 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2-(4-bromo-2-ethylhexyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | CCC(Br)CC(CC)CN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C20H22BrNO2/c1-3-13(11-15(21)4-2)12-22-19(23)16-9-5-7-14-8-6-10-17(18(14)16)20(22)24/h5-10,13,15H,3-4,11-12H2,1-2H3 |
| InChIKey | FHBWIPWGHKLCSN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|