C53H43N5O4 — CID 101223130
2-[9-benzyl-6-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)carbazol-3-yl]-6-piperidin-1-ylbenzo[de]isoquinoline-1,3-dione (PubChem CID 101223130) has the molecular formula C53H43N5O4 and a molecular weight of 813.96 g/mol. Its IUPAC name is 2-[9-benzyl-6-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)carbazol-3-yl]-6-piperidin-1-ylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[9-benzyl-6-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)carbazol-3-yl]-6-piperidin-1-ylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 101223130 |
| Molecular Formula | C53H43N5O4 |
| Molecular Weight | 813.96 g/mol |
| Exact Mass | 813.33 |
| IUPAC Name | 2-[9-benzyl-6-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)carbazol-3-yl]-6-piperidin-1-ylbenzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c(N4CCCCC4)ccc(c23)C(=O)N1c1ccc2c(c1)c1cc(N3C(=O)c4cccc5c(N6CCCCC6)ccc(c45)C3=O)ccc1n2Cc1ccccc1 |
| InChI | InChI=1S/C53H43N5O4/c59-50-38-16-10-14-36-44(54-26-6-2-7-27-54)24-20-40(48(36)38)52(61)57(50)34-18-22-46-42(30-34)43-31-35(19-23-47(43)56(46)32-33-12-4-1-5-13-33)58-51(60)39-17-11-15-37-45(55-28-8-3-9-29-55)25-21-41(49(37)39)53(58)62/h1,4-5,10-25,30-31H,2-3,6-9,26-29,32H2 |
| InChIKey | FHHGZWBTQGGKDV-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 86.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.96 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|