C41H38N4O6 — CID 101027483
2-[3-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]-6-octylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 101027483) has the molecular formula C41H38N4O6 and a molecular weight of 682.78 g/mol. Its IUPAC name is 2-[3-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]-6-octylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-[3-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]-6-octylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 101027483 |
| Molecular Formula | C41H38N4O6 |
| Molecular Weight | 682.78 g/mol |
| Exact Mass | 682.28 |
| IUPAC Name | 2-[3-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]-6-octylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CCCCCCCCn1c(=O)c2cc3c(=O)n(-c4cccc(N5C(=O)c6cccc7c(N8CCCCC8)ccc(c67)C5=O)c4)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C41H38N4O6/c1-2-3-4-5-6-10-21-43-36(46)30-23-32-33(24-31(30)37(43)47)41(51)45(40(32)50)26-14-11-13-25(22-26)44-38(48)28-16-12-15-27-34(42-19-8-7-9-20-42)18-17-29(35(27)28)39(44)49/h11-18,22-24H,2-10,19-21H2,1H3 |
| InChIKey | BOHRFBRVMZUBJZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 118.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.78 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|