C28H28N4O3 — CID 130472264
6-(azepan-1-yl)-2-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzo[de]isoquinoline-1,3-dione (PubChem CID 130472264) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 6-(azepan-1-yl)-2-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-(azepan-1-yl)-2-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 130472264 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 6-(azepan-1-yl)-2-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1cc2c(cc1N1C(=O)c3cccc4c(N5CCCCCC5)ccc(c34)C1=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C28H28N4O3/c1-17-15-23-24(30(3)28(35)29(23)2)16-22(17)32-26(33)19-10-8-9-18-21(31-13-6-4-5-7-14-31)12-11-20(25(18)19)27(32)34/h8-12,15-16H,4-7,13-14H2,1-3H3 |
| InChIKey | WTCDETRQQLGYTO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 67.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|